Products
| Catalog No | RP04163 |
| Name | nitric acid compound with N-phenylguanidine (1:1) |
| CAS No. | 18860-78-1 |
| M.W. | O[N+]([O-])=O.NC(NC1=CC=CC=C1)=N |
| M.F. | C7H10N4O3 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |
Products
| Catalog No | RP04163 |
| Name | nitric acid compound with N-phenylguanidine (1:1) |
| CAS No. | 18860-78-1 |
| M.W. | O[N+]([O-])=O.NC(NC1=CC=CC=C1)=N |
| M.F. | C7H10N4O3 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |