Products
| Catalog No | RP34147 |
| Name | 1,3-bis(4-nitrophenyl)urea compound with 4,6-dimethylpyrimidin-2(1H)-one (1:1) |
| CAS No. | 330-95-0 |
| M.W. | O=C(NC1=CC=C([N+]([O-])=O)C=C1)NC2=CC=C([N+]([O-])=O)C=C2.O=C3N=C(C)C=C(C)N3 |
| M.F. | C19H18N6O6 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |
Products
| Catalog No | RP34147 |
| Name | 1,3-bis(4-nitrophenyl)urea compound with 4,6-dimethylpyrimidin-2(1H)-one (1:1) |
| CAS No. | 330-95-0 |
| M.W. | O=C(NC1=CC=C([N+]([O-])=O)C=C1)NC2=CC=C([N+]([O-])=O)C=C2.O=C3N=C(C)C=C(C)N3 |
| M.F. | C19H18N6O6 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |