
Products
| Catalog No | RL03662 |
| Name | (S)-2-Amino-5-guanidinopentanoic acid compound with (S)-2-aminopentanedioic acid (1:1) |
| CAS No. | 4320-30-3 |
| M.W. | O=C(O)[C@@H](N)CCCNC(N)=N.O=C(O)[C@@H](N)CCC(O)=O |
| M.F. | C11H23N5O6 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |
Products
| Catalog No | RL03662 |
| Name | (S)-2-Amino-5-guanidinopentanoic acid compound with (S)-2-aminopentanedioic acid (1:1) |
| CAS No. | 4320-30-3 |
| M.W. | O=C(O)[C@@H](N)CCCNC(N)=N.O=C(O)[C@@H](N)CCC(O)=O |
| M.F. | C11H23N5O6 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |