
Products
| Catalog No | RL02815 |
| Name | 2-(tert-butyl)-4-methoxyphenol compound with 3-(tert-butyl)-4-methoxyphenol |
| CAS No. | 25013-16-5 |
| M.W. | OC1=CC=C(OC)C=C1C(C)(C)C.OC2=CC=C(OC)C(C(C)(C)C)=C2 |
| M.F. | C11H16O2 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |
Products
| Catalog No | RL02815 |
| Name | 2-(tert-butyl)-4-methoxyphenol compound with 3-(tert-butyl)-4-methoxyphenol |
| CAS No. | 25013-16-5 |
| M.W. | OC1=CC=C(OC)C=C1C(C)(C)C.OC2=CC=C(OC)C(C(C)(C)C)=C2 |
| M.F. | C11H16O2 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |