
Products
| Catalog No | RP28446 |
| Name | 2,4,6-trivinyl-1,3,5,2,4,6-trioxatriborinane compound with pyridine (1:1) |
| CAS No. | 92988-08-4 |
| M.W. | C=CB1OB(C=C)OB(C=C)O1.C2=NC=CC=C2 |
| M.F. | C11H14B3NO3 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |
Products
| Catalog No | RP28446 |
| Name | 2,4,6-trivinyl-1,3,5,2,4,6-trioxatriborinane compound with pyridine (1:1) |
| CAS No. | 92988-08-4 |
| M.W. | C=CB1OB(C=C)OB(C=C)O1.C2=NC=CC=C2 |
| M.F. | C11H14B3NO3 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |