Products
| Catalog No | RP11478 |
| Name | (3aR,4S,7R,7aS)-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione compound with ethane (1:1) |
| CAS No. | 25134-21-8 |
| M.W. | O=C1OC([C@]2([H])[C@](C3)([H])C=C[C@]3([H])[C@@]21[H])=O.CC |
| M.F. | C11H14O3 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |
Products
| Catalog No | RP11478 |
| Name | (3aR,4S,7R,7aS)-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione compound with ethane (1:1) |
| CAS No. | 25134-21-8 |
| M.W. | O=C1OC([C@]2([H])[C@](C3)([H])C=C[C@]3([H])[C@@]21[H])=O.CC |
| M.F. | C11H14O3 |
| Purity | > 97% |
| Storage | |
| Pack | 50mg, 1g, 10g, 100g, Bulk Quantity |
| >> Inquire |